C13H26N2O3S2 — CID 58607871
2-[2-(2-propylpentanoylamino)ethyldisulfanyl]ethyl carbamate (PubChem CID 58607871) has the molecular formula C13H26N2O3S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-[2-(2-propylpentanoylamino)ethyldisulfanyl]ethyl carbamate.
| Compound Name | 2-[2-(2-propylpentanoylamino)ethyldisulfanyl]ethyl carbamate |
|---|---|
| PubChem CID | 58607871 |
| Molecular Formula | C13H26N2O3S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[2-(2-propylpentanoylamino)ethyldisulfanyl]ethyl carbamate |
| SMILES | CCCC(CCC)C(=O)NCCSSCCOC(N)=O |
| InChI | InChI=1S/C13H26N2O3S2/c1-3-5-11(6-4-2)12(16)15-7-9-19-20-10-8-18-13(14)17/h11H,3-10H2,1-2H3,(H2,14,17)(H,15,16) |
| InChIKey | VAEYZEISRSODIZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|