About 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen
2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen (PubChem CID 178107959) has the molecular formula C10H23NO2S2
and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen.
Molecular Properties
| Compound Name | 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen |
| PubChem CID | 178107959 |
| Molecular Formula | C10H23NO2S2 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen |
| SMILES | CCCC[C@H](C)CSSCCOC(N)=O.[H][H] |
| InChI | InChI=1S/C10H21NO2S2.H2/c1-3-4-5-9(2)8-15-14-7-6-13-10(11)12;/h9H,3-8H2,1-2H3,(H2,11,12);1H/t9-;/m0./s1 |
| InChIKey | UVIBBXGFRBMPNH-FVGYRXGTSA-N |
| XLogP | 3.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen?
The IUPAC name of 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen (CID 178107959) is 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen.
What is the SMILES notation for 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen?
The canonical SMILES for 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen is CCCC[C@H](C)CSSCCOC(N)=O.[H][H].
What is the InChIKey of 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen?
The InChIKey is UVIBBXGFRBMPNH-FVGYRXGTSA-N. The full InChI is InChI=1S/C10H21NO2S2.H2/c1-3-4-5-9(2)8-15-14-7-6-13-10(11)12;/h9H,3-8H2,1-2H3,(H2,11,12);1H/t9-;/m0./s1.
What are the key properties of 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen?
2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen has a molecular weight of 253.43 g/mol, XLogP of 3.54, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-2-methylhexyl]disulfanyl]ethyl carbamate;molecular hydrogen is sourced from PubChem (CID 178107959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).