About carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate
carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate (PubChem CID 123473532) has the molecular formula C23H40O6S2
and a molecular weight of 476.70 g/mol. Its IUPAC name is carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate.
Molecular Properties
| Compound Name | carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate |
| PubChem CID | 123473532 |
| Molecular Formula | C23H40O6S2 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCCSSCCOC(=O)CCC1(C)CCCCC1.O=C=O |
| InChI | InChI=1S/C22H40O4S2.CO2/c1-4-9-19(10-5-2)21(24)26-16-18-28-27-17-15-25-20(23)11-14-22(3)12-7-6-8-13-22;2-1-3/h19H,4-18H2,1-3H3; |
| InChIKey | DOMNCNUIOZACPC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
The IUPAC name of carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate (CID 123473532) is carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate.
What is the SMILES notation for carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
The canonical SMILES for carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate is CCCC(CCC)C(=O)OCCSSCCOC(=O)CCC1(C)CCCCC1.O=C=O.
What is the InChIKey of carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
The InChIKey is DOMNCNUIOZACPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O4S2.CO2/c1-4-9-19(10-5-2)21(24)26-16-18-28-27-17-15-25-20(23)11-14-22(3)12-7-6-8-13-22;2-1-3/h19H,4-18H2,1-3H3;.
What are the key properties of carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate?
carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate has a molecular weight of 476.70 g/mol, XLogP of 5.84, 15 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-[2-[3-(1-methylcyclohexyl)propanoyloxy]ethyldisulfanyl]ethyl 2-propylpentanoate is sourced from PubChem (CID 123473532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).