C43H82N2O8S2 — CID 176670574
2-[2-decanoyloxyethyl-[2-[2-[4-(diethylamino)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl]amino]ethyl 2-hexyldecanoate (PubChem CID 176670574) has the molecular formula C43H82N2O8S2 and a molecular weight of 819.27 g/mol. Its IUPAC name is 2-[2-decanoyloxyethyl-[2-[2-[4-(diethylamino)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl]amino]ethyl 2-hexyldecanoate.
| Compound Name | 2-[2-decanoyloxyethyl-[2-[2-[4-(diethylamino)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl]amino]ethyl 2-hexyldecanoate |
|---|---|
| PubChem CID | 176670574 |
| Molecular Formula | C43H82N2O8S2 |
| Molecular Weight | 819.27 g/mol |
| Exact Mass | 818.55 |
| IUPAC Name | 2-[2-decanoyloxyethyl-[2-[2-[4-(diethylamino)butanoyloxy]ethyldisulfanyl]ethoxycarbonyl]amino]ethyl 2-hexyldecanoate |
| SMILES | CCCCCCCCCC(=O)OCCN(CCOC(=O)C(CCCCCC)CCCCCCCC)C(=O)OCCSSCCOC(=O)CCCN(CC)CC |
| InChI | InChI=1S/C43H82N2O8S2/c1-6-11-14-17-19-21-24-28-40(46)50-33-31-45(32-34-52-42(48)39(26-22-16-13-8-3)27-23-20-18-15-12-7-2)43(49)53-36-38-55-54-37-35-51-41(47)29-25-30-44(9-4)10-5/h39H,6-38H2,1-5H3 |
| InChIKey | DSFLYFMCQBAZKL-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.27 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|