C55H108N4O8 — CID 177165295
2-pentylheptyl 6-[2-[3-(diethylamino)propyl-[2-[[6-oxo-6-(2-pentylheptoxy)hexyl]-propylcarbamoyl]oxyethyl]amino]ethoxycarbonyl-propylamino]hexanoate (PubChem CID 177165295) has the molecular formula C55H108N4O8 and a molecular weight of 953.49 g/mol. Its IUPAC name is 2-pentylheptyl 6-[2-[3-(diethylamino)propyl-[2-[[6-oxo-6-(2-pentylheptoxy)hexyl]-propylcarbamoyl]oxyethyl]amino]ethoxycarbonyl-propylamino]hexanoate.
| Compound Name | 2-pentylheptyl 6-[2-[3-(diethylamino)propyl-[2-[[6-oxo-6-(2-pentylheptoxy)hexyl]-propylcarbamoyl]oxyethyl]amino]ethoxycarbonyl-propylamino]hexanoate |
|---|---|
| PubChem CID | 177165295 |
| Molecular Formula | C55H108N4O8 |
| Molecular Weight | 953.49 g/mol |
| Exact Mass | 952.82 |
| IUPAC Name | 2-pentylheptyl 6-[2-[3-(diethylamino)propyl-[2-[[6-oxo-6-(2-pentylheptoxy)hexyl]-propylcarbamoyl]oxyethyl]amino]ethoxycarbonyl-propylamino]hexanoate |
| SMILES | CCCCCC(CCCCC)COC(=O)CCCCCN(CCC)C(=O)OCCN(CCCN(CC)CC)CCOC(=O)N(CCC)CCCCCC(=O)OCC(CCCCC)CCCCC |
| InChI | InChI=1S/C55H108N4O8/c1-9-17-23-32-50(33-24-18-10-2)48-66-52(60)36-27-21-29-42-58(38-13-5)54(62)64-46-44-57(41-31-40-56(15-7)16-8)45-47-65-55(63)59(39-14-6)43-30-22-28-37-53(61)67-49-51(34-25-19-11-3)35-26-20-12-4/h50-51H,9-49H2,1-8H3 |
| InChIKey | HUBMTBSMYCYTIH-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.49 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|