C59H114N2O7 — CID 142457222
2-hexyldecyl 6-[3-[2-acetyloxyethyl(octanoyl)amino]propyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate (PubChem CID 142457222) has the molecular formula C59H114N2O7 and a molecular weight of 963.57 g/mol. Its IUPAC name is 2-hexyldecyl 6-[3-[2-acetyloxyethyl(octanoyl)amino]propyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate.
| Compound Name | 2-hexyldecyl 6-[3-[2-acetyloxyethyl(octanoyl)amino]propyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate |
|---|---|
| PubChem CID | 142457222 |
| Molecular Formula | C59H114N2O7 |
| Molecular Weight | 963.57 g/mol |
| Exact Mass | 962.86 |
| IUPAC Name | 2-hexyldecyl 6-[3-[2-acetyloxyethyl(octanoyl)amino]propyl-[6-(2-hexyldecoxy)-6-oxohexyl]amino]hexanoate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCN(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)CCCN(CCOC(C)=O)C(=O)CCCCCCC |
| InChI | InChI=1S/C59H114N2O7/c1-7-12-17-22-25-31-41-55(39-29-20-15-10-4)52-67-58(64)44-34-27-36-46-60(48-38-49-61(50-51-66-54(6)62)57(63)43-33-24-19-14-9-3)47-37-28-35-45-59(65)68-53-56(40-30-21-16-11-5)42-32-26-23-18-13-8-2/h55-56H,7-53H2,1-6H3 |
| InChIKey | GLGDYHPILGOXIC-UHFFFAOYSA-N |
| XLogP | 16.31 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.57 |
| LogP ≤ 5 | 16.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|