C12H21NO4S — CID 104570312
2-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104570312) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104570312 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[2-[[1-(hydroxymethyl)cyclohexyl]methylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C12H21NO4S/c14-9-12(4-2-1-3-5-12)8-13-10(15)6-18-7-11(16)17/h14H,1-9H2,(H,13,15)(H,16,17) |
| InChIKey | ZVNDHTFFLDBTKY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |