C32H49NO6 — CID 90049732
2-[1-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 90049732) has the molecular formula C32H49NO6 and a molecular weight of 543.75 g/mol. Its IUPAC name is 2-[1-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 90049732 |
| Molecular Formula | C32H49NO6 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 2-[1-[[1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(C)OC(=O)NCC1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C32H49NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23-30(36)38-28(2)39-31(37)33-27-32(26-29(34)35)24-21-19-22-25-32/h4-5,7-8,10-11,13-14,16-17,28H,3,6,9,12,15,18-27H2,1-2H3,(H,33,37)(H,34,35)/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | NWSAVDPQXUTXLZ-JEBPEJKESA-N |
| XLogP | 7.95 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|