C16H27NO9S — CID 25008986
2-[1-[2-oxo-2-[1-(3-sulfopropylcarbamoyloxy)ethoxy]ethyl]cyclohexyl]acetic acid (PubChem CID 25008986) has the molecular formula C16H27NO9S and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[1-[2-oxo-2-[1-(3-sulfopropylcarbamoyloxy)ethoxy]ethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-oxo-2-[1-(3-sulfopropylcarbamoyloxy)ethoxy]ethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 25008986 |
| Molecular Formula | C16H27NO9S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[1-[2-oxo-2-[1-(3-sulfopropylcarbamoyloxy)ethoxy]ethyl]cyclohexyl]acetic acid |
| SMILES | CC(OC(=O)CC1(CC(=O)O)CCCCC1)OC(=O)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C16H27NO9S/c1-12(26-15(21)17-8-5-9-27(22,23)24)25-14(20)11-16(10-13(18)19)6-3-2-4-7-16/h12H,2-11H2,1H3,(H,17,21)(H,18,19)(H,22,23,24) |
| InChIKey | XJNZKVXVGFNHNA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|