C20H25NO7 — CID 10271751
2-[1-[[1-(2-oxo-2-phenylacetyl)oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 10271751) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-[1-[[1-(2-oxo-2-phenylacetyl)oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[1-(2-oxo-2-phenylacetyl)oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 10271751 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[1-[[1-(2-oxo-2-phenylacetyl)oxyethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | CC(OC(=O)NCC1(CC(=O)O)CCCCC1)OC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO7/c1-14(27-18(25)17(24)15-8-4-2-5-9-15)28-19(26)21-13-20(12-16(22)23)10-6-3-7-11-20/h2,4-5,8-9,14H,3,6-7,10-13H2,1H3,(H,21,26)(H,22,23) |
| InChIKey | MRKSRRJRKURAMZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|