C25H29NO6 — CID 22340972
2-[1-[[(2-benzoyloxy-2-phenylethoxy)carbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 22340972) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[1-[[(2-benzoyloxy-2-phenylethoxy)carbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[(2-benzoyloxy-2-phenylethoxy)carbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 22340972 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[1-[[(2-benzoyloxy-2-phenylethoxy)carbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CNC(=O)OCC(OC(=O)c2ccccc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C25H29NO6/c27-22(28)16-25(14-8-3-9-15-25)18-26-24(30)31-17-21(19-10-4-1-5-11-19)32-23(29)20-12-6-2-7-13-20/h1-2,4-7,10-13,21H,3,8-9,14-18H2,(H,26,30)(H,27,28) |
| InChIKey | JCCJYSHEJZQMBV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |