C19H24N2O9 — CID 10070975
2-[1-[[[2-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 10070975) has the molecular formula C19H24N2O9 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-[1-[[[2-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[[2-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 10070975 |
| Molecular Formula | C19H24N2O9 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[1-[[[2-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CNC(=O)OCOC(=O)c2ccccc2CO[N+](=O)[O-])CCCCC1 |
| InChI | InChI=1S/C19H24N2O9/c22-16(23)10-19(8-4-1-5-9-19)12-20-18(25)29-13-28-17(24)15-7-3-2-6-14(15)11-30-21(26)27/h2-3,6-7H,1,4-5,8-13H2,(H,20,25)(H,22,23) |
| InChIKey | SRGKOSQAWXPLNY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|