C24H44N2O9 — CID 142907888
ethane;2-[1-[(2-methylprop-2-enoyloxymethoxycarbonylamino)methyl]cyclohexyl]acetic acid;[(Z)-pent-3-enyl] nitrate (PubChem CID 142907888) has the molecular formula C24H44N2O9 and a molecular weight of 504.62 g/mol. Its IUPAC name is ethane;2-[1-[(2-methylprop-2-enoyloxymethoxycarbonylamino)methyl]cyclohexyl]acetic acid;[(Z)-pent-3-enyl] nitrate.
| Compound Name | ethane;2-[1-[(2-methylprop-2-enoyloxymethoxycarbonylamino)methyl]cyclohexyl]acetic acid;[(Z)-pent-3-enyl] nitrate |
|---|---|
| PubChem CID | 142907888 |
| Molecular Formula | C24H44N2O9 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | ethane;2-[1-[(2-methylprop-2-enoyloxymethoxycarbonylamino)methyl]cyclohexyl]acetic acid;[(Z)-pent-3-enyl] nitrate |
| SMILES | C/C=C\CCO[N+](=O)[O-].C=C(C)C(=O)OCOC(=O)NCC1(CC(=O)O)CCCCC1.CC.CC |
| InChI | InChI=1S/C15H23NO6.C5H9NO3.2C2H6/c1-11(2)13(19)21-10-22-14(20)16-9-15(8-12(17)18)6-4-3-5-7-15;1-2-3-4-5-9-6(7)8;2*1-2/h1,3-10H2,2H3,(H,16,20)(H,17,18);2-3H,4-5H2,1H3;2*1-2H3/b;3-2-;; |
| InChIKey | NEAPSMYWKFOZST-IHFQCQFOSA-N |
| XLogP | 5.43 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|