C13H23NO6S — CID 89420121
methylsulfonyl 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate (PubChem CID 89420121) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is methylsulfonyl 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate.
| Compound Name | methylsulfonyl 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 89420121 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methylsulfonyl 2-[1-[(ethoxycarbonylamino)methyl]cyclohexyl]acetate |
| SMILES | CCOC(=O)NCC1(CC(=O)OS(C)(=O)=O)CCCCC1 |
| InChI | InChI=1S/C13H23NO6S/c1-3-19-12(16)14-10-13(7-5-4-6-8-13)9-11(15)20-21(2,17)18/h3-10H2,1-2H3,(H,14,16) |
| InChIKey | JNYOYQWKJJDLNY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|