C24H30N2O4 — CID 7212844
[(1S)-2-[1-[(dimethylamino)methyl]cyclohexyl]-1-phenylethyl] 4-nitrobenzoate (PubChem CID 7212844) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [(1S)-2-[1-[(dimethylamino)methyl]cyclohexyl]-1-phenylethyl] 4-nitrobenzoate.
| Compound Name | [(1S)-2-[1-[(dimethylamino)methyl]cyclohexyl]-1-phenylethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7212844 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [(1S)-2-[1-[(dimethylamino)methyl]cyclohexyl]-1-phenylethyl] 4-nitrobenzoate |
| SMILES | CN(C)CC1(C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C24H30N2O4/c1-25(2)18-24(15-7-4-8-16-24)17-22(19-9-5-3-6-10-19)30-23(27)20-11-13-21(14-12-20)26(28)29/h3,5-6,9-14,22H,4,7-8,15-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | UXEKRVFCTZLYSL-QFIPXVFZSA-N |
| XLogP | 5.40 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|