C27H32N2O4Si2 — CID 148756420
[(2S)-1-[methyl(diphenyl)silyl]-3-[(2S)-2-silylpyrrolidin-2-yl]propan-2-yl] 4-nitrobenzoate (PubChem CID 148756420) has the molecular formula C27H32N2O4Si2 and a molecular weight of 504.74 g/mol. Its IUPAC name is [(2S)-1-[methyl(diphenyl)silyl]-3-[(2S)-2-silylpyrrolidin-2-yl]propan-2-yl] 4-nitrobenzoate.
| Compound Name | [(2S)-1-[methyl(diphenyl)silyl]-3-[(2S)-2-silylpyrrolidin-2-yl]propan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 148756420 |
| Molecular Formula | C27H32N2O4Si2 |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [(2S)-1-[methyl(diphenyl)silyl]-3-[(2S)-2-silylpyrrolidin-2-yl]propan-2-yl] 4-nitrobenzoate |
| SMILES | C[Si](C[C@H](C[C@@]1([SiH3])CCCN1)OC(=O)c1ccc([N+](=O)[O-])cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32N2O4Si2/c1-35(24-9-4-2-5-10-24,25-11-6-3-7-12-25)20-23(19-27(34)17-8-18-28-27)33-26(30)21-13-15-22(16-14-21)29(31)32/h2-7,9-16,23,28H,8,17-20H2,1,34H3/t23-,27-/m0/s1 |
| InChIKey | OFRURFZUVZIXQU-HOFKKMOUSA-N |
| XLogP | 2.85 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|