C32H38N2O6Si — CID 166022786
tert-butyl (2S)-2-[(2S)-3-[methyl(diphenyl)silyl]-2-(4-nitrobenzoyl)oxypropyl]pyrrolidine-1-carboxylate (PubChem CID 166022786) has the molecular formula C32H38N2O6Si and a molecular weight of 574.75 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2S)-3-[methyl(diphenyl)silyl]-2-(4-nitrobenzoyl)oxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2S)-3-[methyl(diphenyl)silyl]-2-(4-nitrobenzoyl)oxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166022786 |
| Molecular Formula | C32H38N2O6Si |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | tert-butyl (2S)-2-[(2S)-3-[methyl(diphenyl)silyl]-2-(4-nitrobenzoyl)oxypropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C[C@@H](C[Si](C)(c1ccccc1)c1ccccc1)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H38N2O6Si/c1-32(2,3)40-31(36)33-21-11-12-26(33)22-27(39-30(35)24-17-19-25(20-18-24)34(37)38)23-41(4,28-13-7-5-8-14-28)29-15-9-6-10-16-29/h5-10,13-20,26-27H,11-12,21-23H2,1-4H3/t26-,27-/m0/s1 |
| InChIKey | IWPUEWOCHPZKNH-SVBPBHIXSA-N |
| XLogP | 5.80 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|