C26H32N2O6 — CID 142507280
tert-butyl 2-[3-(4-nitrobenzoyl)oxy-3-phenylbutyl]pyrrolidine-1-carboxylate (PubChem CID 142507280) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-nitrobenzoyl)oxy-3-phenylbutyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(4-nitrobenzoyl)oxy-3-phenylbutyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142507280 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | tert-butyl 2-[3-(4-nitrobenzoyl)oxy-3-phenylbutyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCC(C)(OC(=O)c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O6/c1-25(2,3)34-24(30)27-18-8-11-21(27)16-17-26(4,20-9-6-5-7-10-20)33-23(29)19-12-14-22(15-13-19)28(31)32/h5-7,9-10,12-15,21H,8,11,16-18H2,1-4H3 |
| InChIKey | MCVGRUGHDNLUHB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|