C22H33NO6 — CID 66584300
acetic acid;[2-methyl-1-[(1-methylcyclohexyl)methylcarbamoyloxy]propyl] benzoate (PubChem CID 66584300) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is acetic acid;[2-methyl-1-[(1-methylcyclohexyl)methylcarbamoyloxy]propyl] benzoate.
| Compound Name | acetic acid;[2-methyl-1-[(1-methylcyclohexyl)methylcarbamoyloxy]propyl] benzoate |
|---|---|
| PubChem CID | 66584300 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | acetic acid;[2-methyl-1-[(1-methylcyclohexyl)methylcarbamoyloxy]propyl] benzoate |
| SMILES | CC(=O)O.CC(C)C(OC(=O)NCC1(C)CCCCC1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H29NO4.C2H4O2/c1-15(2)18(24-17(22)16-10-6-4-7-11-16)25-19(23)21-14-20(3)12-8-5-9-13-20;1-2(3)4/h4,6-7,10-11,15,18H,5,8-9,12-14H2,1-3H3,(H,21,23);1H3,(H,3,4) |
| InChIKey | PJWUKBCESXKIJL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|