C18H32N2O6 — CID 11959209
2-[1-[[[1-(2-amino-2-methylpropanoyl)oxy-2-methylpropoxy]carbonylamino]methyl]cyclohexyl]acetic acid (PubChem CID 11959209) has the molecular formula C18H32N2O6 and a molecular weight of 372.46 g/mol. Its IUPAC name is 2-[1-[[[1-(2-amino-2-methylpropanoyl)oxy-2-methylpropoxy]carbonylamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[[1-(2-amino-2-methylpropanoyl)oxy-2-methylpropoxy]carbonylamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 11959209 |
| Molecular Formula | C18H32N2O6 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[1-[[[1-(2-amino-2-methylpropanoyl)oxy-2-methylpropoxy]carbonylamino]methyl]cyclohexyl]acetic acid |
| SMILES | CC(C)C(OC(=O)NCC1(CC(=O)O)CCCCC1)OC(=O)C(C)(C)N |
| InChI | InChI=1S/C18H32N2O6/c1-12(2)14(25-15(23)17(3,4)19)26-16(24)20-11-18(10-13(21)22)8-6-5-7-9-18/h12,14H,5-11,19H2,1-4H3,(H,20,24)(H,21,22) |
| InChIKey | NVIKLSBIGABKDR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|