C15H28ClNO4Si — CID 69331107
trimethylsilyl 2-[1-[(1-chloroethoxycarbonylamino)methyl]cyclohexyl]acetate (PubChem CID 69331107) has the molecular formula C15H28ClNO4Si and a molecular weight of 349.93 g/mol. Its IUPAC name is trimethylsilyl 2-[1-[(1-chloroethoxycarbonylamino)methyl]cyclohexyl]acetate.
| Compound Name | trimethylsilyl 2-[1-[(1-chloroethoxycarbonylamino)methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 69331107 |
| Molecular Formula | C15H28ClNO4Si |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | trimethylsilyl 2-[1-[(1-chloroethoxycarbonylamino)methyl]cyclohexyl]acetate |
| SMILES | CC(Cl)OC(=O)NCC1(CC(=O)O[Si](C)(C)C)CCCCC1 |
| InChI | InChI=1S/C15H28ClNO4Si/c1-12(16)20-14(19)17-11-15(8-6-5-7-9-15)10-13(18)21-22(2,3)4/h12H,5-11H2,1-4H3,(H,17,19) |
| InChIKey | DUSVPQAKRPGACE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|