C17H32ClNO4Si — CID 69331057
trimethylsilyl 2-[1-[[(1-chloro-2-methylpropoxy)carbonylamino]methyl]cyclohexyl]acetate (PubChem CID 69331057) has the molecular formula C17H32ClNO4Si and a molecular weight of 377.99 g/mol. Its IUPAC name is trimethylsilyl 2-[1-[[(1-chloro-2-methylpropoxy)carbonylamino]methyl]cyclohexyl]acetate.
| Compound Name | trimethylsilyl 2-[1-[[(1-chloro-2-methylpropoxy)carbonylamino]methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 69331057 |
| Molecular Formula | C17H32ClNO4Si |
| Molecular Weight | 377.99 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | trimethylsilyl 2-[1-[[(1-chloro-2-methylpropoxy)carbonylamino]methyl]cyclohexyl]acetate |
| SMILES | CC(C)C(Cl)OC(=O)NCC1(CC(=O)O[Si](C)(C)C)CCCCC1 |
| InChI | InChI=1S/C17H32ClNO4Si/c1-13(2)15(18)22-16(21)19-12-17(9-7-6-8-10-17)11-14(20)23-24(3,4)5/h13,15H,6-12H2,1-5H3,(H,19,21) |
| InChIKey | IUZWYNXDDWRNMF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.99 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|