C15H26ClNO4 — CID 174574455
(1-chloro-2-methylpropyl) 2-amino-2-[1-(2-methoxy-2-oxoethyl)cyclohexyl]acetate (PubChem CID 174574455) has the molecular formula C15H26ClNO4 and a molecular weight of 319.83 g/mol. Its IUPAC name is (1-chloro-2-methylpropyl) 2-amino-2-[1-(2-methoxy-2-oxoethyl)cyclohexyl]acetate.
| Compound Name | (1-chloro-2-methylpropyl) 2-amino-2-[1-(2-methoxy-2-oxoethyl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 174574455 |
| Molecular Formula | C15H26ClNO4 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (1-chloro-2-methylpropyl) 2-amino-2-[1-(2-methoxy-2-oxoethyl)cyclohexyl]acetate |
| SMILES | COC(=O)CC1(C(N)C(=O)OC(Cl)C(C)C)CCCCC1 |
| InChI | InChI=1S/C15H26ClNO4/c1-10(2)13(16)21-14(19)12(17)15(9-11(18)20-3)7-5-4-6-8-15/h10,12-13H,4-9,17H2,1-3H3 |
| InChIKey | NHKNABSHDHUNNB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|