C20H30N4O12 — CID 145463230
[6-[2-[2-[2-(2-hydroxy-4-methoxy-3-methylanilino)-2-oxoethoxy]ethoxy]ethylamino]-1-nitrooxy-6-oxohexan-2-yl] nitrate (PubChem CID 145463230) has the molecular formula C20H30N4O12 and a molecular weight of 518.48 g/mol. Its IUPAC name is [6-[2-[2-[2-(2-hydroxy-4-methoxy-3-methylanilino)-2-oxoethoxy]ethoxy]ethylamino]-1-nitrooxy-6-oxohexan-2-yl] nitrate.
| Compound Name | [6-[2-[2-[2-(2-hydroxy-4-methoxy-3-methylanilino)-2-oxoethoxy]ethoxy]ethylamino]-1-nitrooxy-6-oxohexan-2-yl] nitrate |
|---|---|
| PubChem CID | 145463230 |
| Molecular Formula | C20H30N4O12 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [6-[2-[2-[2-(2-hydroxy-4-methoxy-3-methylanilino)-2-oxoethoxy]ethoxy]ethylamino]-1-nitrooxy-6-oxohexan-2-yl] nitrate |
| SMILES | COc1ccc(NC(=O)COCCOCCNC(=O)CCCC(CO[N+](=O)[O-])O[N+](=O)[O-])c(O)c1C |
| InChI | InChI=1S/C20H30N4O12/c1-14-17(32-2)7-6-16(20(14)27)22-19(26)13-34-11-10-33-9-8-21-18(25)5-3-4-15(36-24(30)31)12-35-23(28)29/h6-7,15,27H,3-5,8-13H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | SUKRGTBQTCAJIA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 210.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|