C12H14N2O10S — CID 59818370
4-(4,5-dinitrooxypentylsulfonyl)benzoic acid (PubChem CID 59818370) has the molecular formula C12H14N2O10S and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-(4,5-dinitrooxypentylsulfonyl)benzoic acid.
| Compound Name | 4-(4,5-dinitrooxypentylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 59818370 |
| Molecular Formula | C12H14N2O10S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 4-(4,5-dinitrooxypentylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)CCCC(CO[N+](=O)[O-])O[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N2O10S/c15-12(16)9-3-5-11(6-4-9)25(21,22)7-1-2-10(24-14(19)20)8-23-13(17)18/h3-6,10H,1-2,7-8H2,(H,15,16) |
| InChIKey | JXJRZRMWKLDLJI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|