C12H14N2O10 — CID 59407319
3,4-dinitrooxybutyl 4-hydroxy-3-methoxybenzoate (PubChem CID 59407319) has the molecular formula C12H14N2O10 and a molecular weight of 346.25 g/mol. Its IUPAC name is 3,4-dinitrooxybutyl 4-hydroxy-3-methoxybenzoate.
| Compound Name | 3,4-dinitrooxybutyl 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 59407319 |
| Molecular Formula | C12H14N2O10 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 3,4-dinitrooxybutyl 4-hydroxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCCC(CO[N+](=O)[O-])O[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C12H14N2O10/c1-21-11-6-8(2-3-10(11)15)12(16)22-5-4-9(24-14(19)20)7-23-13(17)18/h2-3,6,9,15H,4-5,7H2,1H3 |
| InChIKey | FKNOMVGFGSWVGM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 160.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|