C15H19N3O10 — CID 58209454
(3,3-dimethyl-5,6-dinitrooxyhexyl) 4-nitrobenzoate (PubChem CID 58209454) has the molecular formula C15H19N3O10 and a molecular weight of 401.33 g/mol. Its IUPAC name is (3,3-dimethyl-5,6-dinitrooxyhexyl) 4-nitrobenzoate.
| Compound Name | (3,3-dimethyl-5,6-dinitrooxyhexyl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 58209454 |
| Molecular Formula | C15H19N3O10 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (3,3-dimethyl-5,6-dinitrooxyhexyl) 4-nitrobenzoate |
| SMILES | CC(C)(CCOC(=O)c1ccc([N+](=O)[O-])cc1)CC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O10/c1-15(2,9-13(28-18(24)25)10-27-17(22)23)7-8-26-14(19)11-3-5-12(6-4-11)16(20)21/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | ANRWNFAYJJPIKT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 174.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|