About 1-chloropropyl nitrate
1-chloropropyl nitrate (PubChem CID 18927537) has the molecular formula C3H6ClNO3
and a molecular weight of 139.54 g/mol. Its IUPAC name is 1-chloropropyl nitrate.
Molecular Properties
| Compound Name | 1-chloropropyl nitrate |
| PubChem CID | 18927537 |
| Molecular Formula | C3H6ClNO3 |
| Molecular Weight | 139.54 g/mol |
| Exact Mass | 139.00 |
| IUPAC Name | 1-chloropropyl nitrate |
| SMILES | CCC(Cl)O[N+](=O)[O-] |
| InChI | InChI=1S/C3H6ClNO3/c1-2-3(4)8-5(6)7/h3H,2H2,1H3 |
| InChIKey | NUKYEBYOLQJHAQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropropyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropropyl nitrate?
The IUPAC name of 1-chloropropyl nitrate (CID 18927537) is 1-chloropropyl nitrate.
What is the SMILES notation for 1-chloropropyl nitrate?
The canonical SMILES for 1-chloropropyl nitrate is CCC(Cl)O[N+](=O)[O-].
What is the InChIKey of 1-chloropropyl nitrate?
The InChIKey is NUKYEBYOLQJHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6ClNO3/c1-2-3(4)8-5(6)7/h3H,2H2,1H3.
What are the key properties of 1-chloropropyl nitrate?
1-chloropropyl nitrate has a molecular weight of 139.54 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropropyl nitrate is sourced from PubChem (CID 18927537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).