C18H32N2O3 — CID 155645164
1-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]propyl nitrate (PubChem CID 155645164) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]propyl nitrate.
| Compound Name | 1-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]propyl nitrate |
|---|---|
| PubChem CID | 155645164 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 1-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]propyl nitrate |
| SMILES | CCC(O[N+](=O)[O-])C12CC3(CC)CC(CC)(CC(CN)(C3)C1)C2 |
| InChI | InChI=1S/C18H32N2O3/c1-4-14(23-20(21)22)18-10-15(5-2)7-16(6-3,11-18)9-17(8-15,12-18)13-19/h14H,4-13,19H2,1-3H3 |
| InChIKey | DWVWGXWVZIAZBM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|