C19H33N3O6 — CID 155645133
[3-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]-1-nitrooxybutan-2-yl] nitrate (PubChem CID 155645133) has the molecular formula C19H33N3O6 and a molecular weight of 399.49 g/mol. Its IUPAC name is [3-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]-1-nitrooxybutan-2-yl] nitrate.
| Compound Name | [3-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]-1-nitrooxybutan-2-yl] nitrate |
|---|---|
| PubChem CID | 155645133 |
| Molecular Formula | C19H33N3O6 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [3-[3-(aminomethyl)-5,7-diethyl-1-adamantyl]-1-nitrooxybutan-2-yl] nitrate |
| SMILES | CCC12CC3(CC)CC(CN)(C1)CC(C(C)C(CO[N+](=O)[O-])O[N+](=O)[O-])(C2)C3 |
| InChI | InChI=1S/C19H33N3O6/c1-4-16-7-17(5-2)9-18(8-16,13-20)12-19(10-16,11-17)14(3)15(28-22(25)26)6-27-21(23)24/h14-15H,4-13,20H2,1-3H3 |
| InChIKey | LFMKMOFADWKZMR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|