C8H16N4O16 — CID 87220576
butane-1,2,3,4-tetrol;[(2R,3S)-1,3,4-trinitrooxybutan-2-yl] nitrate (PubChem CID 87220576) has the molecular formula C8H16N4O16 and a molecular weight of 424.23 g/mol. Its IUPAC name is butane-1,2,3,4-tetrol;[(2R,3S)-1,3,4-trinitrooxybutan-2-yl] nitrate.
| Compound Name | butane-1,2,3,4-tetrol;[(2R,3S)-1,3,4-trinitrooxybutan-2-yl] nitrate |
|---|---|
| PubChem CID | 87220576 |
| Molecular Formula | C8H16N4O16 |
| Molecular Weight | 424.23 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | butane-1,2,3,4-tetrol;[(2R,3S)-1,3,4-trinitrooxybutan-2-yl] nitrate |
| SMILES | O=[N+]([O-])OC[C@H](O[N+](=O)[O-])[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-].OCC(O)C(O)CO |
| InChI | InChI=1S/C4H6N4O12.C4H10O4/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12;5-1-3(7)4(8)2-6/h3-4H,1-2H2;3-8H,1-2H2/t3-,4+; |
| InChIKey | FGRJPKRIGBNWDH-HKTIBRIUSA-N |
| XLogP | -3.75 |
| TPSA | 290.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.23 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|