C7H9N7O21 — CID 177459956
[(2R,3R,5R,6R)-1,2,4,5,6,7-hexanitrooxyheptan-3-yl] nitrate (PubChem CID 177459956) has the molecular formula C7H9N7O21 and a molecular weight of 527.18 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-1,2,4,5,6,7-hexanitrooxyheptan-3-yl] nitrate.
| Compound Name | [(2R,3R,5R,6R)-1,2,4,5,6,7-hexanitrooxyheptan-3-yl] nitrate |
|---|---|
| PubChem CID | 177459956 |
| Molecular Formula | C7H9N7O21 |
| Molecular Weight | 527.18 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | [(2R,3R,5R,6R)-1,2,4,5,6,7-hexanitrooxyheptan-3-yl] nitrate |
| SMILES | O=[N+]([O-])OC[C@@H](O[N+](=O)[O-])[C@@H](O[N+](=O)[O-])C(O[N+](=O)[O-])[C@H](O[N+](=O)[O-])[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C7H9N7O21/c15-8(16)29-1-3(31-10(19)20)5(33-12(23)24)7(35-14(27)28)6(34-13(25)26)4(32-11(21)22)2-30-9(17)18/h3-7H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | KVYCTDWNAJMNPM-KVTDHHQDSA-N |
| XLogP | -2.71 |
| TPSA | 366.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.18 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|