C8H14N6O15 — CID 11853019
[(1R,2R,3S)-4-(dimethylamino)-1-[(1R)-1,2-dinitrooxyethyl]-2,3-dinitrooxybutyl] nitrate (PubChem CID 11853019) has the molecular formula C8H14N6O15 and a molecular weight of 434.23 g/mol. Its IUPAC name is [(1R,2R,3S)-4-(dimethylamino)-1-[(1R)-1,2-dinitrooxyethyl]-2,3-dinitrooxybutyl] nitrate.
| Compound Name | [(1R,2R,3S)-4-(dimethylamino)-1-[(1R)-1,2-dinitrooxyethyl]-2,3-dinitrooxybutyl] nitrate |
|---|---|
| PubChem CID | 11853019 |
| Molecular Formula | C8H14N6O15 |
| Molecular Weight | 434.23 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [(1R,2R,3S)-4-(dimethylamino)-1-[(1R)-1,2-dinitrooxyethyl]-2,3-dinitrooxybutyl] nitrate |
| SMILES | CN(C)C[C@H](O[N+](=O)[O-])[C@@H](O[N+](=O)[O-])[C@H](O[N+](=O)[O-])[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N6O15/c1-9(2)3-5(26-11(17)18)7(28-13(21)22)8(29-14(23)24)6(27-12(19)20)4-25-10(15)16/h5-8H,3-4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | IVTVCXKREJFJKZ-LXGUWJNJSA-N |
| XLogP | -1.94 |
| TPSA | 265.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.23 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|