C4H9N3O4 — CID 15751539
N,N-dimethyl-2,2-dinitroethanamine (PubChem CID 15751539) has the molecular formula C4H9N3O4 and a molecular weight of 163.13 g/mol. Its IUPAC name is N,N-dimethyl-2,2-dinitroethanamine.
| Compound Name | N,N-dimethyl-2,2-dinitroethanamine |
|---|---|
| PubChem CID | 15751539 |
| Molecular Formula | C4H9N3O4 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | N,N-dimethyl-2,2-dinitroethanamine |
| SMILES | CN(C)CC([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H9N3O4/c1-5(2)3-4(6(8)9)7(10)11/h4H,3H2,1-2H3 |
| InChIKey | DDZZVYLXSQHWND-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|