C7H15N3O4 — CID 13498213
N,N-diethyl-2,2-dinitropropan-1-amine (PubChem CID 13498213) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is N,N-diethyl-2,2-dinitropropan-1-amine.
| Compound Name | N,N-diethyl-2,2-dinitropropan-1-amine |
|---|---|
| PubChem CID | 13498213 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N,N-diethyl-2,2-dinitropropan-1-amine |
| SMILES | CCN(CC)CC(C)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H15N3O4/c1-4-8(5-2)6-7(3,9(11)12)10(13)14/h4-6H2,1-3H3 |
| InChIKey | WXYVKHMASUPSRG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|