C21H37N3O6 — CID 155645153
[1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]-3-nitrooxypropan-2-yl] nitrate (PubChem CID 155645153) has the molecular formula C21H37N3O6 and a molecular weight of 427.54 g/mol. Its IUPAC name is [1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]-3-nitrooxypropan-2-yl] nitrate.
| Compound Name | [1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]-3-nitrooxypropan-2-yl] nitrate |
|---|---|
| PubChem CID | 155645153 |
| Molecular Formula | C21H37N3O6 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | [1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]-3-nitrooxypropan-2-yl] nitrate |
| SMILES | CCCC12CC3(CCC)CC(CCN)(C1)CC(CC(CO[N+](=O)[O-])O[N+](=O)[O-])(C2)C3 |
| InChI | InChI=1S/C21H37N3O6/c1-3-5-18-11-19(6-4-2)13-20(12-18,7-8-22)16-21(14-18,15-19)9-17(30-24(27)28)10-29-23(25)26/h17H,3-16,22H2,1-2H3 |
| InChIKey | YWEGMZQHDQWYSM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|