C15H25N3O6 — CID 164865530
[1-[5-(2-aminoethyl)-7,7-dimethyl-3-bicyclo[3.3.1]non-1-enyl]-2-nitrooxyethyl] nitrate (PubChem CID 164865530) has the molecular formula C15H25N3O6 and a molecular weight of 343.38 g/mol. Its IUPAC name is [1-[5-(2-aminoethyl)-7,7-dimethyl-3-bicyclo[3.3.1]non-1-enyl]-2-nitrooxyethyl] nitrate.
| Compound Name | [1-[5-(2-aminoethyl)-7,7-dimethyl-3-bicyclo[3.3.1]non-1-enyl]-2-nitrooxyethyl] nitrate |
|---|---|
| PubChem CID | 164865530 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | [1-[5-(2-aminoethyl)-7,7-dimethyl-3-bicyclo[3.3.1]non-1-enyl]-2-nitrooxyethyl] nitrate |
| SMILES | CC1(C)CC2=CC(C(CO[N+](=O)[O-])O[N+](=O)[O-])CC(CCN)(C2)C1 |
| InChI | InChI=1S/C15H25N3O6/c1-14(2)6-11-5-12(8-15(7-11,10-14)3-4-16)13(24-18(21)22)9-23-17(19)20/h5,12-13H,3-4,6-10,16H2,1-2H3 |
| InChIKey | YQUSVZBDXVNIOW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|