About CID 53356918
CID 53356918 (PubChem CID 53356918) has the molecular formula C12H22N3O8
and a molecular weight of 336.32 g/mol.
Molecular Properties
| Compound Name | CID 53356918 |
| PubChem CID | 53356918 |
| Molecular Formula | C12H22N3O8 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OCC(CO[N+](=O)[O-])O[N+](=O)[O-])CC(C)(C)N1[O] |
| InChI | InChI=1S/C12H22N3O8/c1-11(2)5-9(6-12(3,4)13(11)16)21-7-10(23-15(19)20)8-22-14(17)18/h9-10H,5-8H2,1-4H3 |
| InChIKey | PZQLVGOLGQAOGK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 137.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 53356918 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53356918?
The IUPAC name of CID 53356918 (CID 53356918) is not available.
What is the SMILES notation for CID 53356918?
The canonical SMILES for CID 53356918 is CC1(C)CC(OCC(CO[N+](=O)[O-])O[N+](=O)[O-])CC(C)(C)N1[O].
What is the InChIKey of CID 53356918?
The InChIKey is PZQLVGOLGQAOGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N3O8/c1-11(2)5-9(6-12(3,4)13(11)16)21-7-10(23-15(19)20)8-22-14(17)18/h9-10H,5-8H2,1-4H3.
What are the key properties of CID 53356918?
CID 53356918 has a molecular weight of 336.32 g/mol, XLogP of 1.16, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53356918 is sourced from PubChem (CID 53356918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).