C16H29ClN2O3 — CID 156632322
1-[3-(2-aminoethyl)-5,7-dimethyl-1-adamantyl]ethyl nitrate;hydrochloride (PubChem CID 156632322) has the molecular formula C16H29ClN2O3 and a molecular weight of 332.87 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-5,7-dimethyl-1-adamantyl]ethyl nitrate;hydrochloride.
| Compound Name | 1-[3-(2-aminoethyl)-5,7-dimethyl-1-adamantyl]ethyl nitrate;hydrochloride |
|---|---|
| PubChem CID | 156632322 |
| Molecular Formula | C16H29ClN2O3 |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-[3-(2-aminoethyl)-5,7-dimethyl-1-adamantyl]ethyl nitrate;hydrochloride |
| SMILES | CC(O[N+](=O)[O-])C12CC3(C)CC(C)(CC(CCN)(C3)C1)C2.Cl |
| InChI | InChI=1S/C16H28N2O3.ClH/c1-12(21-18(19)20)16-9-13(2)6-14(3,10-16)8-15(7-13,11-16)4-5-17;/h12H,4-11,17H2,1-3H3;1H |
| InChIKey | BXOHVGOLZRJODI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|