C20H36N2O3 — CID 155645179
1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]ethyl nitrate (PubChem CID 155645179) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]ethyl nitrate.
| Compound Name | 1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]ethyl nitrate |
|---|---|
| PubChem CID | 155645179 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | 1-[3-(2-aminoethyl)-5,7-dipropyl-1-adamantyl]ethyl nitrate |
| SMILES | CCCC12CC3(CCC)CC(CCN)(C1)CC(C(C)O[N+](=O)[O-])(C2)C3 |
| InChI | InChI=1S/C20H36N2O3/c1-4-6-17-10-18(7-5-2)12-19(11-17,8-9-21)15-20(13-17,14-18)16(3)25-22(23)24/h16H,4-15,21H2,1-3H3 |
| InChIKey | VYQGCOWVSJGUKM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|