C15H26N2O3 — CID 155354576
1-[3-(2-aminoethyl)-5-methyl-1-adamantyl]ethyl nitrate (PubChem CID 155354576) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-5-methyl-1-adamantyl]ethyl nitrate.
| Compound Name | 1-[3-(2-aminoethyl)-5-methyl-1-adamantyl]ethyl nitrate |
|---|---|
| PubChem CID | 155354576 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[3-(2-aminoethyl)-5-methyl-1-adamantyl]ethyl nitrate |
| SMILES | CC(O[N+](=O)[O-])C12CC3CC(C)(CC(CCN)(C3)C1)C2 |
| InChI | InChI=1S/C15H26N2O3/c1-11(20-17(18)19)15-7-12-5-13(2,9-15)8-14(6-12,10-15)3-4-16/h11-12H,3-10,16H2,1-2H3 |
| InChIKey | ZXUPZVROEYFYSF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|