C13H25ClO — CID 139794632
2,3,4,4-tetramethyl-2-(2-methylpropyl)pentanoyl chloride (PubChem CID 139794632) has the molecular formula C13H25ClO and a molecular weight of 232.79 g/mol. Its IUPAC name is 2,3,4,4-tetramethyl-2-(2-methylpropyl)pentanoyl chloride.
| Compound Name | 2,3,4,4-tetramethyl-2-(2-methylpropyl)pentanoyl chloride |
|---|---|
| PubChem CID | 139794632 |
| Molecular Formula | C13H25ClO |
| Molecular Weight | 232.79 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2,3,4,4-tetramethyl-2-(2-methylpropyl)pentanoyl chloride |
| SMILES | CC(C)CC(C)(C(=O)Cl)C(C)C(C)(C)C |
| InChI | InChI=1S/C13H25ClO/c1-9(2)8-13(7,11(14)15)10(3)12(4,5)6/h9-10H,8H2,1-7H3 |
| InChIKey | WUOZHKOLNQDPFB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|