C14H29NO2 — CID 115968914
N-(4-hydroxy-2-methylbutan-2-yl)-3,5,5-trimethylhexanamide (PubChem CID 115968914) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutan-2-yl)-3,5,5-trimethylhexanamide.
| Compound Name | N-(4-hydroxy-2-methylbutan-2-yl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 115968914 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | N-(4-hydroxy-2-methylbutan-2-yl)-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NC(C)(C)CCO)CC(C)(C)C |
| InChI | InChI=1S/C14H29NO2/c1-11(10-13(2,3)4)9-12(17)15-14(5,6)7-8-16/h11,16H,7-10H2,1-6H3,(H,15,17) |
| InChIKey | BOMNAMUJFCHSBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |