C23H49NO — CID 178061969
ethane;3,3,5,5-tetramethyl-N-(2,2,4,4,5-pentamethylhexyl)hexanamide (PubChem CID 178061969) has the molecular formula C23H49NO and a molecular weight of 355.65 g/mol. Its IUPAC name is ethane;3,3,5,5-tetramethyl-N-(2,2,4,4,5-pentamethylhexyl)hexanamide.
| Compound Name | ethane;3,3,5,5-tetramethyl-N-(2,2,4,4,5-pentamethylhexyl)hexanamide |
|---|---|
| PubChem CID | 178061969 |
| Molecular Formula | C23H49NO |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 355.38 |
| IUPAC Name | ethane;3,3,5,5-tetramethyl-N-(2,2,4,4,5-pentamethylhexyl)hexanamide |
| SMILES | CC.CC(C)C(C)(C)CC(C)(C)CNC(=O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H43NO.C2H6/c1-16(2)21(10,11)14-20(8,9)15-22-17(23)12-19(6,7)13-18(3,4)5;1-2/h16H,12-15H2,1-11H3,(H,22,23);1-2H3 |
| InChIKey | DHPZNQOBKHRCMO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |