C22H48N2O2 — CID 144742394
methanamine;propane;2,2,3-trimethyl-N-(2,2,4,4-tetramethyl-6-oxoheptyl)butanamide (PubChem CID 144742394) has the molecular formula C22H48N2O2 and a molecular weight of 372.64 g/mol. Its IUPAC name is methanamine;propane;2,2,3-trimethyl-N-(2,2,4,4-tetramethyl-6-oxoheptyl)butanamide.
| Compound Name | methanamine;propane;2,2,3-trimethyl-N-(2,2,4,4-tetramethyl-6-oxoheptyl)butanamide |
|---|---|
| PubChem CID | 144742394 |
| Molecular Formula | C22H48N2O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.37 |
| IUPAC Name | methanamine;propane;2,2,3-trimethyl-N-(2,2,4,4-tetramethyl-6-oxoheptyl)butanamide |
| SMILES | CC(=O)CC(C)(C)CC(C)(C)CNC(=O)C(C)(C)C(C)C.CCC.CN |
| InChI | InChI=1S/C18H35NO2.C3H8.CH5N/c1-13(2)18(8,9)15(21)19-12-17(6,7)11-16(4,5)10-14(3)20;1-3-2;1-2/h13H,10-12H2,1-9H3,(H,19,21);3H2,1-2H3;2H2,1H3 |
| InChIKey | ZJHGWEFMSOLBOH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |