C14H27NO3S — CID 178049712
[2-oxo-2-(2,2,4,4,5-pentamethylhexylamino)ethoxy]methanethioic S-acid (PubChem CID 178049712) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is [2-oxo-2-(2,2,4,4,5-pentamethylhexylamino)ethoxy]methanethioic S-acid.
| Compound Name | [2-oxo-2-(2,2,4,4,5-pentamethylhexylamino)ethoxy]methanethioic S-acid |
|---|---|
| PubChem CID | 178049712 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [2-oxo-2-(2,2,4,4,5-pentamethylhexylamino)ethoxy]methanethioic S-acid |
| SMILES | CC(C)C(C)(C)CC(C)(C)CNC(=O)COC(=O)S |
| InChI | InChI=1S/C14H27NO3S/c1-10(2)14(5,6)8-13(3,4)9-15-11(16)7-18-12(17)19/h10H,7-9H2,1-6H3,(H,15,16)(H,17,19) |
| InChIKey | XLOBARCNURBCJJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|