C14H29NO2S — CID 178049911
(1-hydroxy-4,4,6,6,7-pentamethyloctan-2-yl)carbamothioic S-acid (PubChem CID 178049911) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is (1-hydroxy-4,4,6,6,7-pentamethyloctan-2-yl)carbamothioic S-acid.
| Compound Name | (1-hydroxy-4,4,6,6,7-pentamethyloctan-2-yl)carbamothioic S-acid |
|---|---|
| PubChem CID | 178049911 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (1-hydroxy-4,4,6,6,7-pentamethyloctan-2-yl)carbamothioic S-acid |
| SMILES | CC(C)C(C)(C)CC(C)(C)CC(CO)NC(=O)S |
| InChI | InChI=1S/C14H29NO2S/c1-10(2)14(5,6)9-13(3,4)7-11(8-16)15-12(17)18/h10-11,16H,7-9H2,1-6H3,(H2,15,17,18) |
| InChIKey | UEXWYLZOHINCPL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|