C12H25NO — CID 142527857
N-(2,4,4,5-tetramethylhexan-2-yl)acetamide (PubChem CID 142527857) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N-(2,4,4,5-tetramethylhexan-2-yl)acetamide.
| Compound Name | N-(2,4,4,5-tetramethylhexan-2-yl)acetamide |
|---|---|
| PubChem CID | 142527857 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N-(2,4,4,5-tetramethylhexan-2-yl)acetamide |
| SMILES | CC(=O)NC(C)(C)CC(C)(C)C(C)C |
| InChI | InChI=1S/C12H25NO/c1-9(2)11(4,5)8-12(6,7)13-10(3)14/h9H,8H2,1-7H3,(H,13,14) |
| InChIKey | GJVMKLKZASQXGD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |