C22H45NO — CID 123857190
2,2,4,4,5,5-hexamethyl-N-(2,4,4,5-tetramethylhexan-2-yl)hexanamide (PubChem CID 123857190) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is 2,2,4,4,5,5-hexamethyl-N-(2,4,4,5-tetramethylhexan-2-yl)hexanamide.
| Compound Name | 2,2,4,4,5,5-hexamethyl-N-(2,4,4,5-tetramethylhexan-2-yl)hexanamide |
|---|---|
| PubChem CID | 123857190 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | 2,2,4,4,5,5-hexamethyl-N-(2,4,4,5-tetramethylhexan-2-yl)hexanamide |
| SMILES | CC(C)C(C)(C)CC(C)(C)NC(=O)C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45NO/c1-16(2)19(6,7)15-22(12,13)23-17(24)20(8,9)14-21(10,11)18(3,4)5/h16H,14-15H2,1-13H3,(H,23,24) |
| InChIKey | SLGGWILNCSXLHS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |