C20H37NO4 — CID 165399193
2,2,4,4-tetramethyl-5-oxo-5-[(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)amino]pentanoic acid (PubChem CID 165399193) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-5-oxo-5-[(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)amino]pentanoic acid.
| Compound Name | 2,2,4,4-tetramethyl-5-oxo-5-[(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 165399193 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 2,2,4,4-tetramethyl-5-oxo-5-[(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)amino]pentanoic acid |
| SMILES | CC(C)C(=O)C(C)(C)CC(C)(C)NC(=O)C(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H37NO4/c1-13(2)14(22)17(3,4)12-20(9,10)21-15(23)18(5,6)11-19(7,8)16(24)25/h13H,11-12H2,1-10H3,(H,21,23)(H,24,25) |
| InChIKey | JAIOSLUSHKESSF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |